C3H5Cl2NO — CID 12663090
N,3-dichloropropanamide (PubChem CID 12663090) has the molecular formula C3H5Cl2NO and a molecular weight of 141.98 g/mol. Its IUPAC name is N,3-dichloropropanamide.
| Compound Name | N,3-dichloropropanamide |
|---|---|
| PubChem CID | 12663090 |
| Molecular Formula | C3H5Cl2NO |
| Molecular Weight | 141.98 g/mol |
| Exact Mass | 140.97 |
| IUPAC Name | N,3-dichloropropanamide |
| SMILES | O=C(CCCl)NCl |
| InChI | InChI=1S/C3H5Cl2NO/c4-2-1-3(7)6-5/h1-2H2,(H,6,7) |
| InChIKey | ZIHMWDBMPZISRL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.98 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|