C12H22N2O3 — CID 114409902
2-amino-4-methoxy-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 114409902) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-amino-4-methoxy-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 2-amino-4-methoxy-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 114409902 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-amino-4-methoxy-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | COCCC(N)C(=O)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C12H22N2O3/c1-16-8-5-11(13)12(15)14-6-3-10(4-7-14)9-17-2/h3,11H,4-9,13H2,1-2H3 |
| InChIKey | KVUPCTGRRYGUTP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|