C16H32N2O2 — CID 143023877
(2S)-2-amino-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3-dimethylbutanamide (PubChem CID 143023877) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is (2S)-2-amino-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143023877 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | (2S)-2-amino-N-[(E,3S)-6-ethoxy-2,5-dimethylhex-4-en-3-yl]-N,3-dimethylbutanamide |
| SMILES | CCOC/C(C)=C/[C@H](C(C)C)N(C)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-8-20-10-13(6)9-14(11(2)3)18(7)16(19)15(17)12(4)5/h9,11-12,14-15H,8,10,17H2,1-7H3/b13-9+/t14-,15+/m1/s1 |
| InChIKey | HQNADPQNCTYEMJ-UXHADMKASA-N |
| XLogP | 2.44 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|