C12H18N2O2 — CID 114409982
2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]butanenitrile (PubChem CID 114409982) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]butanenitrile.
| Compound Name | 2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]butanenitrile |
|---|---|
| PubChem CID | 114409982 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]butanenitrile |
| SMILES | CCC(C#N)C(=O)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-11(8-13)12(15)14-6-4-10(5-7-14)9-16-2/h4,11H,3,5-7,9H2,1-2H3 |
| InChIKey | VYVKXNGUBUBBCB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|