C8H10N2O2 — CID 57161474
2-hydroxy-1,4-dimethyl-6-oxo-2,5-dihydropyridine-5-carbonitrile (PubChem CID 57161474) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-hydroxy-1,4-dimethyl-6-oxo-2,5-dihydropyridine-5-carbonitrile.
| Compound Name | 2-hydroxy-1,4-dimethyl-6-oxo-2,5-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 57161474 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-hydroxy-1,4-dimethyl-6-oxo-2,5-dihydropyridine-5-carbonitrile |
| SMILES | CC1=CC(O)N(C)C(=O)C1C#N |
| InChI | InChI=1S/C8H10N2O2/c1-5-3-7(11)10(2)8(12)6(5)4-9/h3,6-7,11H,1-2H3 |
| InChIKey | GEGZBMSPYPPZKN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|