C14H17NO2 — CID 114410228
1-[2-(3,6-dihydro-2H-pyridin-1-yl)-6-methoxyphenyl]ethanone (PubChem CID 114410228) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyridin-1-yl)-6-methoxyphenyl]ethanone.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyridin-1-yl)-6-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 114410228 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyridin-1-yl)-6-methoxyphenyl]ethanone |
| SMILES | COc1cccc(N2CC=CCC2)c1C(C)=O |
| InChI | InChI=1S/C14H17NO2/c1-11(16)14-12(7-6-8-13(14)17-2)15-9-4-3-5-10-15/h3-4,6-8H,5,9-10H2,1-2H3 |
| InChIKey | XAXPGJVKSAWCQQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|