C10H20N2 — CID 114410601
N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]propan-2-amine (PubChem CID 114410601) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 114410601 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCN1CC=CCC1 |
| InChI | InChI=1S/C10H20N2/c1-10(2)11-6-9-12-7-4-3-5-8-12/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | IBEVFQQOHHMOSW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|