C17H21NO3 — CID 114411497
(E)-3-[4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methylphenyl]prop-2-enoic acid (PubChem CID 114411497) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (E)-3-[4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114411497 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (E)-3-[4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methylphenyl]prop-2-enoic acid |
| SMILES | COCC1=CCN(c2ccc(/C=C/C(=O)O)c(C)c2)CC1 |
| InChI | InChI=1S/C17H21NO3/c1-13-11-16(5-3-15(13)4-6-17(19)20)18-9-7-14(8-10-18)12-21-2/h3-7,11H,8-10,12H2,1-2H3,(H,19,20)/b6-4+ |
| InChIKey | RFNMJFPHHUPWIK-GQCTYLIASA-N |
| XLogP | 2.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|