C18H17NO2 — CID 76937352
3-[4-(1,3-dihydroisoindol-2-yl)-2-methylphenyl]prop-2-enoic acid (PubChem CID 76937352) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[4-(1,3-dihydroisoindol-2-yl)-2-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(1,3-dihydroisoindol-2-yl)-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76937352 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[4-(1,3-dihydroisoindol-2-yl)-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(N2Cc3ccccc3C2)ccc1C=CC(=O)O |
| InChI | InChI=1S/C18H17NO2/c1-13-10-17(8-6-14(13)7-9-18(20)21)19-11-15-4-2-3-5-16(15)12-19/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | QJOKXCLHGCDTLR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|