C18H29N3 — CID 114412705
N-[[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propan-2-yl-4-pyridinyl]methyl]propan-2-amine (PubChem CID 114412705) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propan-2-yl-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propan-2-yl-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114412705 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N-[[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propan-2-yl-4-pyridinyl]methyl]propan-2-amine |
| SMILES | CC1=CCN(c2cc(CNC(C)C)cc(C(C)C)n2)CC1 |
| InChI | InChI=1S/C18H29N3/c1-13(2)17-10-16(12-19-14(3)4)11-18(20-17)21-8-6-15(5)7-9-21/h6,10-11,13-14,19H,7-9,12H2,1-5H3 |
| InChIKey | YEOKPOQNUGMEJL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|