C13H26N2 — CID 114413331
2-methyl-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propan-2-ylpropan-1-amine (PubChem CID 114413331) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-methyl-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propan-2-ylpropan-1-amine.
| Compound Name | 2-methyl-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 114413331 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-methyl-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propan-2-ylpropan-1-amine |
| SMILES | CC1=CCN(CC(C)CNC(C)C)CC1 |
| InChI | InChI=1S/C13H26N2/c1-11(2)14-9-13(4)10-15-7-5-12(3)6-8-15/h5,11,13-14H,6-10H2,1-4H3 |
| InChIKey | MWKQRAZBRYXASD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|