C9H18N2O — CID 114460118
1-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol (PubChem CID 114460118) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol.
| Compound Name | 1-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 114460118 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-amino-3-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
| SMILES | CC1=CCN(CC(O)CN)CC1 |
| InChI | InChI=1S/C9H18N2O/c1-8-2-4-11(5-3-8)7-9(12)6-10/h2,9,12H,3-7,10H2,1H3 |
| InChIKey | CGUWZTOWMMWYEM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|