C17H24N2O — CID 114412947
N-[[4-[2-(3,6-dihydro-2H-pyridin-1-yl)ethoxy]phenyl]methyl]cyclopropanamine (PubChem CID 114412947) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[[4-[2-(3,6-dihydro-2H-pyridin-1-yl)ethoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-[2-(3,6-dihydro-2H-pyridin-1-yl)ethoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114412947 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-[[4-[2-(3,6-dihydro-2H-pyridin-1-yl)ethoxy]phenyl]methyl]cyclopropanamine |
| SMILES | C1=CCN(CCOc2ccc(CNC3CC3)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O/c1-2-10-19(11-3-1)12-13-20-17-8-4-15(5-9-17)14-18-16-6-7-16/h1-2,4-5,8-9,16,18H,3,6-7,10-14H2 |
| InChIKey | FCDHPBNIGGOMRG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|