C15H30N2O — CID 114413531
N-tert-butyl-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-amine (PubChem CID 114413531) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-amine.
| Compound Name | N-tert-butyl-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 114413531 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-tert-butyl-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-amine |
| SMILES | CCC(CNC(C)(C)C)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-6-14(11-16-15(2,3)4)17-9-7-13(8-10-17)12-18-5/h7,14,16H,6,8-12H2,1-5H3 |
| InChIKey | XMPDFKGCQLBXID-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|