C14H17N — CID 114415138
N-[(2-cyclopropylphenyl)methyl]but-3-yn-2-amine (PubChem CID 114415138) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(2-cyclopropylphenyl)methyl]but-3-yn-2-amine.
| Compound Name | N-[(2-cyclopropylphenyl)methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114415138 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(2-cyclopropylphenyl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1ccccc1C1CC1 |
| InChI | InChI=1S/C14H17N/c1-3-11(2)15-10-13-6-4-5-7-14(13)12-8-9-12/h1,4-7,11-12,15H,8-10H2,2H3 |
| InChIKey | RVZQLTVFPAMANU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|