C16H19NS — CID 81398472
(1R)-N-[(2-cyclopropylphenyl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 81398472) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is (1R)-N-[(2-cyclopropylphenyl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | (1R)-N-[(2-cyclopropylphenyl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 81398472 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (1R)-N-[(2-cyclopropylphenyl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | C[C@@H](NCc1ccccc1C1CC1)c1cccs1 |
| InChI | InChI=1S/C16H19NS/c1-12(16-7-4-10-18-16)17-11-14-5-2-3-6-15(14)13-8-9-13/h2-7,10,12-13,17H,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | XLKOPYBAXPDMDY-GFCCVEGCSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |