C22H24Cl2N2O2 — CID 11441515
[3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidin-1-yl]-piperidin-1-ylmethanone (PubChem CID 11441515) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is [3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidin-1-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidin-1-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 11441515 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [3-[(2-chlorophenyl)-(4-chlorophenyl)methoxy]azetidin-1-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1CC(OC(c2ccc(Cl)cc2)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c23-17-10-8-16(9-11-17)21(19-6-2-3-7-20(19)24)28-18-14-26(15-18)22(27)25-12-4-1-5-13-25/h2-3,6-11,18,21H,1,4-5,12-15H2 |
| InChIKey | KOGILAIJMSNWDT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |