C10H15N3 — CID 114415294
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]but-3-yn-2-amine (PubChem CID 114415294) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]but-3-yn-2-amine.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114415294 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H15N3/c1-5-7(2)11-6-10-8(3)12-13-9(10)4/h1,7,11H,6H2,2-4H3,(H,12,13) |
| InChIKey | RQAXVQPOFAHWGX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|