C11H11N3 — CID 114417379
2-(but-3-yn-2-ylamino)-6-methylpyridine-3-carbonitrile (PubChem CID 114417379) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(but-3-yn-2-ylamino)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-(but-3-yn-2-ylamino)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 114417379 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(but-3-yn-2-ylamino)-6-methylpyridine-3-carbonitrile |
| SMILES | C#CC(C)Nc1nc(C)ccc1C#N |
| InChI | InChI=1S/C11H11N3/c1-4-8(2)13-11-10(7-12)6-5-9(3)14-11/h1,5-6,8H,2-3H3,(H,13,14) |
| InChIKey | XIARGHSJRSPVST-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|