C11H9FN6O — CID 114417709
5-fluoro-2-methyl-4-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline (PubChem CID 114417709) has the molecular formula C11H9FN6O and a molecular weight of 260.23 g/mol. Its IUPAC name is 5-fluoro-2-methyl-4-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline.
| Compound Name | 5-fluoro-2-methyl-4-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline |
|---|---|
| PubChem CID | 114417709 |
| Molecular Formula | C11H9FN6O |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-fluoro-2-methyl-4-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline |
| SMILES | Cc1cc(Oc2cncc3nnnn23)c(F)cc1N |
| InChI | InChI=1S/C11H9FN6O/c1-6-2-9(7(12)3-8(6)13)19-11-5-14-4-10-15-16-17-18(10)11/h2-5H,13H2,1H3 |
| InChIKey | NIXWPYWCSVMUIF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|