C12H17NO3 — CID 114418702
4-(but-3-yn-2-ylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 114418702) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-(but-3-yn-2-ylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(but-3-yn-2-ylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114418702 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-(but-3-yn-2-ylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | C#CC(C)NC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H17NO3/c1-3-8(2)13-11(14)9-4-6-10(7-5-9)12(15)16/h1,8-10H,4-7H2,2H3,(H,13,14)(H,15,16) |
| InChIKey | NLWCYYDPQUCVNT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|