C12H16F3NO — CID 114418969
N-but-3-yn-2-yl-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 114418969) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is N-but-3-yn-2-yl-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-but-3-yn-2-yl-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114418969 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-but-3-yn-2-yl-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | C#CC(C)NC(=O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H16F3NO/c1-3-8(2)16-11(17)9-4-6-10(7-5-9)12(13,14)15/h1,8-10H,4-7H2,2H3,(H,16,17) |
| InChIKey | WMIIEYZTUGDWOW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|