C9H12N2O3S — CID 114419106
N-but-3-yn-2-yl-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 114419106) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is N-but-3-yn-2-yl-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-but-3-yn-2-yl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 114419106 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N-but-3-yn-2-yl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | C#CC(C)NS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C9H12N2O3S/c1-5-6(2)11-15(12,13)9-7(3)10-14-8(9)4/h1,6,11H,2-4H3 |
| InChIKey | QGFRVXJZCXPMKY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|