C17H20N2O2 — CID 114420572
1-but-3-yn-2-yl-6-phenyl-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 114420572) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-but-3-yn-2-yl-6-phenyl-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-but-3-yn-2-yl-6-phenyl-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 114420572 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-but-3-yn-2-yl-6-phenyl-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | C#CC(C)N1C(=O)C(C(C)C)NC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-5-12(4)19-15(13-9-7-6-8-10-13)16(20)18-14(11(2)3)17(19)21/h1,6-12,14-15H,2-4H3,(H,18,20) |
| InChIKey | AHIBOVYLJIWRLA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|