C14H13F2N3O2 — CID 114420658
5-amino-3-but-3-yn-2-yl-4-[2-(difluoromethoxy)phenyl]-4H-imidazol-2-one (PubChem CID 114420658) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is 5-amino-3-but-3-yn-2-yl-4-[2-(difluoromethoxy)phenyl]-4H-imidazol-2-one.
| Compound Name | 5-amino-3-but-3-yn-2-yl-4-[2-(difluoromethoxy)phenyl]-4H-imidazol-2-one |
|---|---|
| PubChem CID | 114420658 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-amino-3-but-3-yn-2-yl-4-[2-(difluoromethoxy)phenyl]-4H-imidazol-2-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C1c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H13F2N3O2/c1-3-8(2)19-11(12(17)18-14(19)20)9-6-4-5-7-10(9)21-13(15)16/h1,4-8,11,13H,2H3,(H2,17,18,20) |
| InChIKey | MIZPVMSJLLHKIX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|