C12H15N3O3 — CID 79959271
5-amino-4-(2,3-dimethoxyphenyl)-3-methyl-4H-imidazol-2-one (PubChem CID 79959271) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-amino-4-(2,3-dimethoxyphenyl)-3-methyl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(2,3-dimethoxyphenyl)-3-methyl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79959271 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 5-amino-4-(2,3-dimethoxyphenyl)-3-methyl-4H-imidazol-2-one |
| SMILES | COc1cccc(C2C(N)=NC(=O)N2C)c1OC |
| InChI | InChI=1S/C12H15N3O3/c1-15-9(11(13)14-12(15)16)7-5-4-6-8(17-2)10(7)18-3/h4-6,9H,1-3H3,(H2,13,14,16) |
| InChIKey | KGABPWTUABICFV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |