C13H12N2O3S — CID 13131698
6-(2-methoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 13131698) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 6-(2-methoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 13131698 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 6-(2-methoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | COc1ccccc1C1C(=O)N=C2SCCN2C1=O |
| InChI | InChI=1S/C13H12N2O3S/c1-18-9-5-3-2-4-8(9)10-11(16)14-13-15(12(10)17)6-7-19-13/h2-5,10H,6-7H2,1H3 |
| InChIKey | LRINHMCPSOVCAP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|