C26H37NO5 — CID 11442137
[(1R,4E,6S,10E,12S,15R,16S,17S)-10,14,15-trimethyl-17-(2-methylpropyl)-3,19-dioxo-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-trien-6-yl] acetate (PubChem CID 11442137) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is [(1R,4E,6S,10E,12S,15R,16S,17S)-10,14,15-trimethyl-17-(2-methylpropyl)-3,19-dioxo-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-trien-6-yl] acetate.
| Compound Name | [(1R,4E,6S,10E,12S,15R,16S,17S)-10,14,15-trimethyl-17-(2-methylpropyl)-3,19-dioxo-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-trien-6-yl] acetate |
|---|---|
| PubChem CID | 11442137 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | [(1R,4E,6S,10E,12S,15R,16S,17S)-10,14,15-trimethyl-17-(2-methylpropyl)-3,19-dioxo-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-trien-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/C(=O)O[C@@]23C(=O)N[C@@H](CC(C)C)[C@@H]2[C@@H](C)C(C)=C[C@@H]3/C=C(\C)CCC1 |
| InChI | InChI=1S/C26H37NO5/c1-15(2)12-22-24-18(5)17(4)14-20-13-16(3)8-7-9-21(31-19(6)28)10-11-23(29)32-26(20,24)25(30)27-22/h10-11,13-15,18,20-22,24H,7-9,12H2,1-6H3,(H,27,30)/b11-10+,16-13+/t18-,20-,21-,22-,24-,26+/m0/s1 |
| InChIKey | XBXVJKZNHUAOQX-WFTHFYSJSA-N |
| XLogP | 4.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|