C15H27N3O — CID 114423145
N-(1-cyclopropylpiperidin-4-yl)-4-methylpiperidine-2-carboxamide (PubChem CID 114423145) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-4-methylpiperidine-2-carboxamide.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 114423145 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-4-methylpiperidine-2-carboxamide |
| SMILES | CC1CCNC(C(=O)NC2CCN(C3CC3)CC2)C1 |
| InChI | InChI=1S/C15H27N3O/c1-11-4-7-16-14(10-11)15(19)17-12-5-8-18(9-6-12)13-2-3-13/h11-14,16H,2-10H2,1H3,(H,17,19) |
| InChIKey | ALAGGIAGDYUYBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |