C12H23Cl2N3O — CID 119864828
(2S)-N-(1-cyclopropylpyrrolidin-3-yl)pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 119864828) has the molecular formula C12H23Cl2N3O and a molecular weight of 296.24 g/mol. Its IUPAC name is (2S)-N-(1-cyclopropylpyrrolidin-3-yl)pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-(1-cyclopropylpyrrolidin-3-yl)pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119864828 |
| Molecular Formula | C12H23Cl2N3O |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2S)-N-(1-cyclopropylpyrrolidin-3-yl)pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCN(C2CC2)C1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H21N3O.2ClH/c16-12(11-2-1-6-13-11)14-9-5-7-15(8-9)10-3-4-10;;/h9-11,13H,1-8H2,(H,14,16);2*1H/t9?,11-;;/m0../s1 |
| InChIKey | WKACLGXKWSXHTL-UIKRKWDSSA-N |
| XLogP | 0.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |