C12H23Cl2N3O2 — CID 119864795
N-(1-cyclopropylpyrrolidin-3-yl)morpholine-3-carboxamide;dihydrochloride (PubChem CID 119864795) has the molecular formula C12H23Cl2N3O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)morpholine-3-carboxamide;dihydrochloride.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)morpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119864795 |
| Molecular Formula | C12H23Cl2N3O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)morpholine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CCN(C2CC2)C1)C1COCCN1 |
| InChI | InChI=1S/C12H21N3O2.2ClH/c16-12(11-8-17-6-4-13-11)14-9-3-5-15(7-9)10-1-2-10;;/h9-11,13H,1-8H2,(H,14,16);2*1H |
| InChIKey | JSMUCRVSGQGZNS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |