C15H20N2O3 — CID 114425770
2-(4-ethylpiperidin-2-yl)-1-(3-nitrophenyl)ethanone (PubChem CID 114425770) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(4-ethylpiperidin-2-yl)-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-(4-ethylpiperidin-2-yl)-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 114425770 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(4-ethylpiperidin-2-yl)-1-(3-nitrophenyl)ethanone |
| SMILES | CCC1CCNC(CC(=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H20N2O3/c1-2-11-6-7-16-13(8-11)10-15(18)12-4-3-5-14(9-12)17(19)20/h3-5,9,11,13,16H,2,6-8,10H2,1H3 |
| InChIKey | ZGQUGRBYMDLHEE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|