C12H21NO2 — CID 114425874
3-(4-ethylpiperidin-2-yl)pentane-2,4-dione (PubChem CID 114425874) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-(4-ethylpiperidin-2-yl)pentane-2,4-dione.
| Compound Name | 3-(4-ethylpiperidin-2-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 114425874 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-(4-ethylpiperidin-2-yl)pentane-2,4-dione |
| SMILES | CCC1CCNC(C(C(C)=O)C(C)=O)C1 |
| InChI | InChI=1S/C12H21NO2/c1-4-10-5-6-13-11(7-10)12(8(2)14)9(3)15/h10-13H,4-7H2,1-3H3 |
| InChIKey | AMTHLLMLRGSSFO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|