C9H16N2O2 — CID 174622514
3-piperazin-2-ylpentane-2,4-dione (PubChem CID 174622514) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-piperazin-2-ylpentane-2,4-dione.
| Compound Name | 3-piperazin-2-ylpentane-2,4-dione |
|---|---|
| PubChem CID | 174622514 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-piperazin-2-ylpentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C1CNCCN1 |
| InChI | InChI=1S/C9H16N2O2/c1-6(12)9(7(2)13)8-5-10-3-4-11-8/h8-11H,3-5H2,1-2H3 |
| InChIKey | UDTCUYBLXMURCR-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|