C23H43N5O8 — CID 68671763
acetic acid;(R)-phenyl-[(2S)-1,4,7,10-tetrazacyclododec-2-yl]methanamine (PubChem CID 68671763) has the molecular formula C23H43N5O8 and a molecular weight of 517.62 g/mol. Its IUPAC name is acetic acid;(R)-phenyl-[(2S)-1,4,7,10-tetrazacyclododec-2-yl]methanamine.
| Compound Name | acetic acid;(R)-phenyl-[(2S)-1,4,7,10-tetrazacyclododec-2-yl]methanamine |
|---|---|
| PubChem CID | 68671763 |
| Molecular Formula | C23H43N5O8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | acetic acid;(R)-phenyl-[(2S)-1,4,7,10-tetrazacyclododec-2-yl]methanamine |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.N[C@H](c1ccccc1)[C@@H]1CNCCNCCNCCN1 |
| InChI | InChI=1S/C15H27N5.4C2H4O2/c16-15(13-4-2-1-3-5-13)14-12-19-9-8-17-6-7-18-10-11-20-14;4*1-2(3)4/h1-5,14-15,17-20H,6-12,16H2;4*1H3,(H,3,4)/t14-,15+;;;;/m0..../s1 |
| InChIKey | DEVARDVUNRUDNE-VSDDYELYSA-N |
| XLogP | -0.21 |
| TPSA | 223.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |