C28H48O5 — CID 11442660
(4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]pentan-1-ol (PubChem CID 11442660) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]pentan-1-ol.
| Compound Name | (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]pentan-1-ol |
|---|---|
| PubChem CID | 11442660 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | (4R)-4-[(5S,7R,8R,9S,10S,13R,14S,17R)-7-(methoxymethoxy)-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]pentan-1-ol |
| SMILES | COCO[C@@H]1C[C@H]2CC3(CC[C@]2(C)[C@H]2CC[C@]4(C)[C@@H]([C@H](C)CCCO)CC[C@H]4[C@H]12)OCCO3 |
| InChI | InChI=1S/C28H48O5/c1-19(6-5-13-29)21-7-8-22-25-23(9-10-27(21,22)3)26(2)11-12-28(32-14-15-33-28)17-20(26)16-24(25)31-18-30-4/h19-25,29H,5-18H2,1-4H3/t19-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChIKey | FYNAQUVRQWXRSW-BRKVWLPFSA-N |
| XLogP | 5.40 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|