C14H24N2O3 — CID 114429627
4-ethyl-1-(2-pyrrolidin-2-ylacetyl)piperidine-2-carboxylic acid (PubChem CID 114429627) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-ethyl-1-(2-pyrrolidin-2-ylacetyl)piperidine-2-carboxylic acid.
| Compound Name | 4-ethyl-1-(2-pyrrolidin-2-ylacetyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114429627 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4-ethyl-1-(2-pyrrolidin-2-ylacetyl)piperidine-2-carboxylic acid |
| SMILES | CCC1CCN(C(=O)CC2CCCN2)C(C(=O)O)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-2-10-5-7-16(12(8-10)14(18)19)13(17)9-11-4-3-6-15-11/h10-12,15H,2-9H2,1H3,(H,18,19) |
| InChIKey | FVLXAGYRRAFPDB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |