About (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate
(3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate (PubChem CID 114430087) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate.
Molecular Properties
| Compound Name | (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate |
| PubChem CID | 114430087 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate |
| SMILES | CCC1CCNC(C(=O)OC2CCCC(OC)C2)C1 |
| InChI | InChI=1S/C15H27NO3/c1-3-11-7-8-16-14(9-11)15(17)19-13-6-4-5-12(10-13)18-2/h11-14,16H,3-10H2,1-2H3 |
| InChIKey | NMXLJZBDCXCGBG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate?
The IUPAC name of (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate (CID 114430087) is (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate.
What is the SMILES notation for (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate?
The canonical SMILES for (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate is CCC1CCNC(C(=O)OC2CCCC(OC)C2)C1.
What is the InChIKey of (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate?
The InChIKey is NMXLJZBDCXCGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-3-11-7-8-16-14(9-11)15(17)19-13-6-4-5-12(10-13)18-2/h11-14,16H,3-10H2,1-2H3.
What are the key properties of (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate?
(3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate has a molecular weight of 269.38 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxycyclohexyl) 4-ethylpiperidine-2-carboxylate is sourced from PubChem (CID 114430087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).