C15H27NO3 — CID 114430100
(2,6-dimethyloxan-4-yl) 4-ethylpiperidine-2-carboxylate (PubChem CID 114430100) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (2,6-dimethyloxan-4-yl) 4-ethylpiperidine-2-carboxylate.
| Compound Name | (2,6-dimethyloxan-4-yl) 4-ethylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 114430100 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2,6-dimethyloxan-4-yl) 4-ethylpiperidine-2-carboxylate |
| SMILES | CCC1CCNC(C(=O)OC2CC(C)OC(C)C2)C1 |
| InChI | InChI=1S/C15H27NO3/c1-4-12-5-6-16-14(9-12)15(17)19-13-7-10(2)18-11(3)8-13/h10-14,16H,4-9H2,1-3H3 |
| InChIKey | WRPWFJNXWDAXQV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |