C25H22BrFN2O2 — CID 11443035
2-benzyl-5-(3-bromo-4-fluorophenyl)-3,5,7,8,9,10-hexahydro-1H-benzo[b][1,7]naphthyridine-4,6-dione (PubChem CID 11443035) has the molecular formula C25H22BrFN2O2 and a molecular weight of 481.37 g/mol. Its IUPAC name is 2-benzyl-5-(3-bromo-4-fluorophenyl)-3,5,7,8,9,10-hexahydro-1H-benzo[b][1,7]naphthyridine-4,6-dione.
| Compound Name | 2-benzyl-5-(3-bromo-4-fluorophenyl)-3,5,7,8,9,10-hexahydro-1H-benzo[b][1,7]naphthyridine-4,6-dione |
|---|---|
| PubChem CID | 11443035 |
| Molecular Formula | C25H22BrFN2O2 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-benzyl-5-(3-bromo-4-fluorophenyl)-3,5,7,8,9,10-hexahydro-1H-benzo[b][1,7]naphthyridine-4,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(F)c(Br)c1)C1=C(CN(Cc3ccccc3)CC1=O)N2 |
| InChI | InChI=1S/C25H22BrFN2O2/c26-17-11-16(9-10-18(17)27)23-24-19(7-4-8-21(24)30)28-20-13-29(14-22(31)25(20)23)12-15-5-2-1-3-6-15/h1-3,5-6,9-11,23,28H,4,7-8,12-14H2 |
| InChIKey | FSGCUFSJIUEZES-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |