C17H21NO2S — CID 114431593
1-(1-benzothiophen-3-ylmethyl)-4-ethylpiperidine-2-carboxylic acid (PubChem CID 114431593) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-4-ethylpiperidine-2-carboxylic acid.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-4-ethylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114431593 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-4-ethylpiperidine-2-carboxylic acid |
| SMILES | CCC1CCN(Cc2csc3ccccc23)C(C(=O)O)C1 |
| InChI | InChI=1S/C17H21NO2S/c1-2-12-7-8-18(15(9-12)17(19)20)10-13-11-21-16-6-4-3-5-14(13)16/h3-6,11-12,15H,2,7-10H2,1H3,(H,19,20) |
| InChIKey | UOFBEWRDYQKJPF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |