C15H15NO3S — CID 10541446
(2S)-1-[2-(1-benzothiophen-3-yl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 10541446) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is (2S)-1-[2-(1-benzothiophen-3-yl)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(1-benzothiophen-3-yl)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10541446 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2S)-1-[2-(1-benzothiophen-3-yl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C15H15NO3S/c17-14(16-7-3-5-12(16)15(18)19)8-10-9-20-13-6-2-1-4-11(10)13/h1-2,4,6,9,12H,3,5,7-8H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | GZWREJWUSZRJDR-LBPRGKRZSA-N |
| XLogP | 2.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |