C32H27NO4 — CID 11443206
methyl (2S)-2-[2,2-diphenylethenyl-(3-oxo-3-phenylpropanoyl)amino]-2-phenylacetate (PubChem CID 11443206) has the molecular formula C32H27NO4 and a molecular weight of 489.57 g/mol. Its IUPAC name is methyl (2S)-2-[2,2-diphenylethenyl-(3-oxo-3-phenylpropanoyl)amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[2,2-diphenylethenyl-(3-oxo-3-phenylpropanoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 11443206 |
| Molecular Formula | C32H27NO4 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | methyl (2S)-2-[2,2-diphenylethenyl-(3-oxo-3-phenylpropanoyl)amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](c1ccccc1)N(C=C(c1ccccc1)c1ccccc1)C(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H27NO4/c1-37-32(36)31(27-20-12-5-13-21-27)33(30(35)22-29(34)26-18-10-4-11-19-26)23-28(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h2-21,23,31H,22H2,1H3/t31-/m0/s1 |
| InChIKey | SQYDYQZOSDHROU-HKBQPEDESA-N |
| XLogP | 6.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|