C26H31NO3 — CID 85354913
methyl 3-[1-cyclohexylethyl(2,2-diphenylethenyl)amino]-3-oxopropanoate (PubChem CID 85354913) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 3-[1-cyclohexylethyl(2,2-diphenylethenyl)amino]-3-oxopropanoate.
| Compound Name | methyl 3-[1-cyclohexylethyl(2,2-diphenylethenyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 85354913 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | methyl 3-[1-cyclohexylethyl(2,2-diphenylethenyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N(C=C(c1ccccc1)c1ccccc1)C(C)C1CCCCC1 |
| InChI | InChI=1S/C26H31NO3/c1-20(21-12-6-3-7-13-21)27(25(28)18-26(29)30-2)19-24(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h4-5,8-11,14-17,19-21H,3,6-7,12-13,18H2,1-2H3 |
| InChIKey | UTZGLCSKVYLFKY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|