C32H36N2O2 — CID 139094266
N-cyclohexyl-N-[2,2-diphenylethenyl(propan-2-yl)carbamoyl]-4-methylbenzamide (PubChem CID 139094266) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-cyclohexyl-N-[2,2-diphenylethenyl(propan-2-yl)carbamoyl]-4-methylbenzamide.
| Compound Name | N-cyclohexyl-N-[2,2-diphenylethenyl(propan-2-yl)carbamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 139094266 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-cyclohexyl-N-[2,2-diphenylethenyl(propan-2-yl)carbamoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C(=O)N(C=C(c2ccccc2)c2ccccc2)C(C)C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H36N2O2/c1-24(2)33(23-30(26-13-7-4-8-14-26)27-15-9-5-10-16-27)32(36)34(29-17-11-6-12-18-29)31(35)28-21-19-25(3)20-22-28/h4-5,7-10,13-16,19-24,29H,6,11-12,17-18H2,1-3H3 |
| InChIKey | DIESMVDUPMHGCW-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'} |
|---|