C32H36N2O2 — CID 132575511
N-cyclohexyl-N-(4-methylbenzoyl)-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 132575511) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-cyclohexyl-N-(4-methylbenzoyl)-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | N-cyclohexyl-N-(4-methylbenzoyl)-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 132575511 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-cyclohexyl-N-(4-methylbenzoyl)-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | Cc1ccc(CN2CCc3ccccc3C2C(=O)N(C(=O)c2ccc(C)cc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H36N2O2/c1-23-12-16-25(17-13-23)22-33-21-20-26-8-6-7-11-29(26)30(33)32(36)34(28-9-4-3-5-10-28)31(35)27-18-14-24(2)15-19-27/h6-8,11-19,28,30H,3-5,9-10,20-22H2,1-2H3 |
| InChIKey | VIDDDYQKVMILCO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|