C23H32NO3P — CID 177440040
1-di(propan-2-yloxy)phosphoryl-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 177440040) has the molecular formula C23H32NO3P and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 177440040 |
| Molecular Formula | C23H32NO3P |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-2-[(4-methylphenyl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc(CN2CCc3ccccc3C2P(=O)(OC(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C23H32NO3P/c1-17(2)26-28(25,27-18(3)4)23-22-9-7-6-8-21(22)14-15-24(23)16-20-12-10-19(5)11-13-20/h6-13,17-18,23H,14-16H2,1-5H3 |
| InChIKey | NHHQYDMAAVPQMF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|