C21H21NO2 — CID 134948857
methyl 4-[(1R)-2-benzyl-3,4-dihydro-1H-isoquinolin-1-yl]but-3-ynoate (PubChem CID 134948857) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 4-[(1R)-2-benzyl-3,4-dihydro-1H-isoquinolin-1-yl]but-3-ynoate.
| Compound Name | methyl 4-[(1R)-2-benzyl-3,4-dihydro-1H-isoquinolin-1-yl]but-3-ynoate |
|---|---|
| PubChem CID | 134948857 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl 4-[(1R)-2-benzyl-3,4-dihydro-1H-isoquinolin-1-yl]but-3-ynoate |
| SMILES | COC(=O)CC#C[C@@H]1c2ccccc2CCN1Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-24-21(23)13-7-12-20-19-11-6-5-10-18(19)14-15-22(20)16-17-8-3-2-4-9-17/h2-6,8-11,20H,13-16H2,1H3/t20-/m1/s1 |
| InChIKey | UYQVOSMJNFMDRO-HXUWFJFHSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|