C29H27ClNO3P — CID 166514673
(1S)-1-bis(phenylmethoxy)phosphoryl-2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 166514673) has the molecular formula C29H27ClNO3P and a molecular weight of 503.97 g/mol. Its IUPAC name is (1S)-1-bis(phenylmethoxy)phosphoryl-2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S)-1-bis(phenylmethoxy)phosphoryl-2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 166514673 |
| Molecular Formula | C29H27ClNO3P |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | (1S)-1-bis(phenylmethoxy)phosphoryl-2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)[C@H]1c2ccccc2CCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H27ClNO3P/c30-26-15-17-27(18-16-26)31-20-19-25-13-7-8-14-28(25)29(31)35(32,33-21-23-9-3-1-4-10-23)34-22-24-11-5-2-6-12-24/h1-18,29H,19-22H2/t29-/m0/s1 |
| InChIKey | VLOTUHXGNHSNRG-LJAQVGFWSA-N |
| XLogP | 8.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|