C34H36N2O3P+ — CID 175359952
bis[[(1S)-2-(4-ethylphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy]-oxophosphanium (PubChem CID 175359952) has the molecular formula C34H36N2O3P+ and a molecular weight of 551.65 g/mol. Its IUPAC name is bis[[(1S)-2-(4-ethylphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy]-oxophosphanium.
| Compound Name | bis[[(1S)-2-(4-ethylphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy]-oxophosphanium |
|---|---|
| PubChem CID | 175359952 |
| Molecular Formula | C34H36N2O3P+ |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | bis[[(1S)-2-(4-ethylphenyl)-3,4-dihydro-1H-isoquinolin-1-yl]oxy]-oxophosphanium |
| SMILES | CCc1ccc(N2CCc3ccccc3[C@@H]2O[P+](=O)O[C@H]2c3ccccc3CCN2c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O3P/c1-3-25-13-17-29(18-14-25)35-23-21-27-9-5-7-11-31(27)33(35)38-40(37)39-34-32-12-8-6-10-28(32)22-24-36(34)30-19-15-26(4-2)16-20-30/h5-20,33-34H,3-4,21-24H2,1-2H3/q+1/t33-,34-/m0/s1 |
| InChIKey | QNOYIPIPBRCCLR-HEVIKAOCSA-N |
| XLogP | 8.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|